| Identification | |
| Name: | 1-Naphthalenecarboxylicacid, 3-nitro- |
| Synonyms: | 1-Naphthoicacid, 3-nitro- (6CI,7CI,8CI);3-Nitro-1-naphthalenecarboxylic acid;3-Nitro-1-naphthoic acid;NSC 26051; |
| CAS: | 4507-84-0 |
| Molecular Formula: | C11H7NO4 |
| Molecular Weight: | 217.18 |
| InChI: | InChI=1/C11H7NO4/c13-11(14)10-6-8(12(15)16)5-7-3-1-2-4-9(7)10/h1-6H,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.468 g/cm3 |
| Refractive index: | 1.706 |
| Specification: |
The cas register number of 3-Nitro-1-naphthoic acid is 4507-84-0. It also can be called as 1-Naphthalenecarboxylicacid, 3-nitro- and the IUPAC Name about this chemical is 3-nitronaphthalene-1-carboxylic acid. Physical properties about 3-Nitro-1-naphthoic acid are: (1)ACD/LogP: 3.05; (2)ACD/LogD (pH 5.5): 0.51; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3.12; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 5; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 72.12Å2; (11)Index of Refraction: 1.706; (12)Molar Refractivity: 57.57 cm3; (13)Molar Volume: 147.9 cm3; (14)Polarizability: 22.82x10-24cm3; (15)Surface Tension: 70.5 dyne/cm; (16)Enthalpy of Vaporization: 74.11 kJ/mol; (17)Boiling Point: 445.2 °C at 760 mmHg; (18)Vapour Pressure: 1.04E-08 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
