| Identification | |
| Name: | 5-Bromovaleryl chloride |
| Synonyms: | Valerylchloride, 5-bromo- (7CI,8CI);5-Bromovaleric acid chloride;5-Bromovaleroylchloride;5-Bromovaleryl chloride, 98%;pentanoyl chloride, 5-bromo-; |
| CAS: | 4509-90-4 |
| Molecular Formula: | C5H8BrClO |
| Molecular Weight: | 199.47 |
| InChI: | InChI=1/C14H11N3O2/c1-9(18)16-11-2-3-13-12(8-11)17-14(19-13)10-4-6-15-7-5-10/h2-8H,1H3,(H,16,18) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.49 |
| Refractive index: | 1.4905-1.493 |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
5-Bromovaleryl chloride , with CAS number of 4509-90-4, can be called Valerylchloride, 5-bromo- (7CI,8CI) ; 5-Bromovaleric acid chloride ; 5-Bromovaleroylchloride ; 5-Bromovaleryl chloride, 98% ; pentanoyl chloride, 5-bromo- . |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
