| Identification | |
| Name: | Benzoic acid,3-fluoro-, ethyl ester |
| Synonyms: | Benzoicacid, m-fluoro-, ethyl ester (6CI,7CI,8CI);Ethyl 3-fluorobenzoate; |
| CAS: | 451-02-5 |
| EINECS: | 207-191-1 |
| Molecular Formula: | C9H9FO2 |
| Molecular Weight: | 168.16 |
| InChI: | InChI=1/C9H9FO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 82ºC |
| Refractive index: | 1.4850 |
| Appearance: | colorless transparent liquid |
| Specification: | White to light yellow crystal powder Safety Statements:24/25-25-24 24/25:Avoid contact with skin and eyes 25:Avoid contact with eyes 24:Avoid contact with skin |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
