Identification |
Name: | Ethanone, 1,2-diphenyl- |
Synonyms: | Acetophenone,2-phenyl- (8CI);1,2-Diphenylethan-1-one;1,2-Diphenylethanone;Benzoin, deoxy-;Benzyl phenyl ketone;Deoxybenzoin;Desoxybenzoin;NSC 131456;NSC 249236;NSC 6097;Phenyl benzyl ketone;Phenylmethyl phenyl ketone;a-Phenylacetophenone; |
CAS: | 451-40-1 |
EINECS: | 207-193-2 |
Molecular Formula: | C14H12O |
Molecular Weight: | 196.25 |
InChI: | InChI=1/C14H12O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2 |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Flash Point: | 319 - 321 C |
Density: | 1.08 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.583 |
Water Solubility: | methanol: 0.1 g/mL, clear |
Solubility: | poor (soluble in hot water) |
Appearance: | white crystals |
Specification: | white to off-white crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
HS Code: | 29143900 |
Flash Point: | 319 - 321 C |
Safety Data |
Hazard Symbols |
|
|
 |