| Identification | |
| Name: | Benzoicacid, 4-fluoro-, ethyl ester |
| Synonyms: | Benzoicacid, p-fluoro-, ethyl ester (6CI,7CI,8CI);4-Carbethoxyphenyl fluoride;4-Fluorobenzoic acid ethyl ester;Ethylp-fluorobenzoate;NSC 190692;4-Fluorobenzoic ethyl ester; |
| CAS: | 451-46-7 |
| EINECS: | 207-194-8 |
| Molecular Formula: | C9H9FO2 |
| Molecular Weight: | 168.17 |
| InChI: | InChI=1/C9H9FO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.146 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.485-1.487 |
| Water Solubility: | 1.485-1.487 |
| Solubility: | 1.485-1.487 |
| Appearance: | colorless transparent liquid |
| Specification: | Colorless to pale yellow low melting solid Safety Statements:23-24/25-25-24 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 25:Avoid contact with eyes 24:Avoid contact with skin |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
