| Identification | |
| Name: | Benzene,1-ethoxy-2-fluoro- |
| Synonyms: | Phenetole,o-fluoro- (8CI);2-Ethoxyfluorobenzene;2-Fluoro-1-ethoxybenzene;2-Fluorophenetole;NSC 89718;o-Fluorophenetole; |
| CAS: | 451-80-9 |
| Molecular Formula: | C8H9FO |
| Molecular Weight: | 140.15 |
| InChI: | InChI=1/C8H9FO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -16.7 |
| Flash Point: | 60.1°C |
| Boiling Point: | 174.6°Cat760mmHg |
| Density: | 1.044g/cm3 |
| Refractive index: | 1.471 |
| Specification: | Safety Statements:26-36-45-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing |
| Flash Point: | 60.1°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
