Identification |
Name: | Benzene,1-ethoxy-2-fluoro- |
Synonyms: | Phenetole,o-fluoro- (8CI);2-Ethoxyfluorobenzene;2-Fluoro-1-ethoxybenzene;2-Fluorophenetole;NSC 89718;o-Fluorophenetole; |
CAS: | 451-80-9 |
Molecular Formula: | C8H9FO |
Molecular Weight: | 140.15 |
InChI: | InChI=1/C8H9FO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | -16.7 |
Flash Point: | 60.1°C |
Boiling Point: | 174.6°Cat760mmHg |
Density: | 1.044g/cm3 |
Refractive index: | 1.471 |
Specification: | Safety Statements:26-36-45-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 27:Take off immediately all contaminated clothing |
Flash Point: | 60.1°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |