| Identification | |
| Name: | 1,4-Dioxane-2,5-dione,3,6-dimethyl-, (3S,6S)- |
| Synonyms: | 1,4-Dioxane-2,5-dione,3,6-dimethyl-, (3S-cis)-;p-Dioxane-2,5-dione, 3,6-dimethyl-, L- (8CI);(-)-L-Dilactide;(3S,6S)-3,6-Dimethyl-1,4-dioxane-2,5-dione;(S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione;1,4-Dioxane-2,5-dione, 3,6-dimethyl-,(3S,5S)-;L,L-Dilactide;L-(-)-Lactide;L-Dilactide;Purasorb L; |
| CAS: | 4511-42-6 |
| EINECS: | 224-832-0 |
| Molecular Formula: | C6H8O4 |
| Molecular Weight: | 144.13 |
| InChI: | InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.186 g/cm3 |
| Refractive index: | 1.4475 |
| Appearance: | White crystalline solide |
| Specification: |
? 1,4-Dioxane-2,5-dione,3,6-dimethyl-, (3S,6S)- ,?its cas register number is 4511-42-6. It also can be called?3S-cis)-3,6-Dimethyl-1,4-dioxane-2,5-dione . 1,4-Dioxane-2,5-dione,3,6-dimethyl-, (3S,6S)- (CAS NO.4511-42-6) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.? |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
