| Identification | |
| Name: | Benzoic acid, 3-amino-,methyl ester |
| Synonyms: | Benzoicacid, m-amino-, methyl ester (6CI,7CI,8CI); (3-(Methoxycarbonyl)phenyl)amine;3-(Methoxycarbonyl)aniline; 3-Aminobenzoic acid methyl ester;3-Carbomethoxyaniline; Methyl 3-aminobenzoate; Methyl 3-aminophenylcarboxylate;Methyl m-aminobenzoate; m-Aminobenzoic acid methyl ester |
| CAS: | 4518-10-9 |
| EINECS: | 224-842-5 |
| Molecular Formula: | C8H9 N O2 |
| Molecular Weight: | 151.1626 |
| InChI: | InChI=1S/C8H9NO2/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 50-54 °C |
| Flash Point: | 140.4°C |
| Boiling Point: | 281.5°Cat760mmHg |
| Density: | 1.166g/cm3 |
| Refractive index: | 1.565 |
| Specification: | light beige to brown cryst. powder or crystals Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 140.4°C |
| Safety Data | |
 |
|
