| Identification | |
| Name: | 2-Aminopurine |
| Synonyms: | 1H-Purin-2-amine(9CI); Purine, 2-amino- (6CI,8CI); 2-Aminopurine; Isoadenine; NSC 24129; SQ22451 |
| CAS: | 452-06-2 |
| EINECS: | 207-197-4 |
| Molecular Formula: | C5H5N5 |
| Molecular Weight: | 135.13 |
| InChI: | InChI=1/C5H5N5/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H3,6,7,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 362.9ºC |
| Boiling Point: | 616.3 ºCat 760 mmHg |
| Density: | 1.612 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.954 |
| Solubility: | Soluble in acid, slightly soluble in hot ethanol, insoluble in alkaline solution |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder usageEng:A probe of structural dynamics and charge transfer in DNA . Safety Statements:22-36-26 22:Do not breathe dust 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 362.9ºC |
| Storage Temperature: | 2-8°C |
| Usage: | A probe of structural dynamics and charge transfer in DNA . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
