| Identification | |
| Name: | Benzene,2,4-difluoro-1-methoxy- |
| Synonyms: | Anisole,2,4-difluoro- (8CI);2,4-Difluoroanisol; |
| CAS: | 452-10-8 |
| Molecular Formula: | C7H6F2O |
| Molecular Weight: | 144.12 |
| InChI: | InChI=1/C7H6F2O/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 1.235 |
| Refractive index: | 1.471-1.473 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Clear colourless to light yellow liquid |
| Specification: |
?2,4-Difluoroanisole (CAS NO.452-10-8) is clear colourless to light yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
