Identification |
Name: | Phenol,4-fluoro-3-methyl- |
Synonyms: | m-Cresol,4-fluoro- (6CI,8CI);2-Fluoro-5-hydroxytoluene;3-Methyl-4-fluorophenol;4-Fluoro-m-cresol; |
CAS: | 452-70-0 |
Molecular Formula: | C7H7FO |
Molecular Weight: | 126.13 |
InChI: | InChI=1S/C7H7FO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 1759 |
Density: | 1.134 |
Refractive index: | 1.515 |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |