Identification |
Name: | Benzene,2-fluoro-1-iodo-4-methyl- |
Synonyms: | Toluene,3-fluoro-4-iodo- (8CI); 2-Fluoro-1-iodo-4-methylbenzene; 3-Fluoro-4-iodotoluene |
CAS: | 452-79-9 |
Molecular Formula: | C7H6 F I |
Molecular Weight: | 236.03 |
InChI: | InChI=1/C7H6FI/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 92 oC |
Density: | 1.803 |
Refractive index: | 1.5810 |
Specification: | colorless to light yellow liqui Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
Flash Point: | 92 oC |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |