| Identification | |
| Name: | 2-Fluoro-4-methylphenol |
| Synonyms: | p-Cresol,2-fluoro- (6CI,7CI,8CI); 2-Fluoro-4-methylphenol; 2-Fluoro-p-cresol |
| CAS: | 452-81-3 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2922 |
| Flash Point: | 66.4°C |
| Boiling Point: | 173°Cat760mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.513 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 66.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
