| Identification | |
| Name: | 2-Chloro-5-fluoroaniline |
| Synonyms: | Aniline,2-chloro-5-fluoro- (8CI);Benzenamine,2-chloro-5-fluoro-; |
| CAS: | 452-83-5 |
| EINECS: | 226-696-8 |
| Molecular Formula: | C6H5ClFN |
| Molecular Weight: | 145.56 |
| InChI: | InChI=1/C6H4BrF2N/c7-3-1-6(10)5(9)2-4(3)8/h1-2H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 1.349g/cm3 |
| Refractive index: | 1.57 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Safety Data | |
 |
|
