Identification |
Name: | 2-Chloro-5-fluoroaniline |
Synonyms: | Aniline,2-chloro-5-fluoro- (8CI);Benzenamine,2-chloro-5-fluoro-; |
CAS: | 452-83-5 |
EINECS: | 226-696-8 |
Molecular Formula: | C6H5ClFN |
Molecular Weight: | 145.56 |
InChI: | InChI=1/C6H4BrF2N/c7-3-1-6(10)5(9)2-4(3)8/h1-2H,10H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN2811 |
Density: | 1.349g/cm3 |
Refractive index: | 1.57 |
Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Packinggroup: | III |
Safety Data |
|
 |