| Identification | |
| Name: | Nitroethyl nitrate [Forbidden] |
| Synonyms: | 2-Nitroethanol nitrate |
| CAS: | 4528-34-1 |
| Molecular Formula: | C2H4N2O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C2H4N2O5/c5-3(6)1-2-9-4(7)8/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.3°C |
| Boiling Point: | 226.2°C at 760 mmHg |
| Density: | 1.455g/cm3 |
| Refractive index: | 1.449 |
| Specification: |
Nitroethyl nitrate [Forbidden] , its cas register number is 4528-34-1. It also can be called 2-Nitroethyl nitrate ; Nitroethyl nitrate ; and Ethanol, 2-nitro-, nitrate (ester) . |
| Flash Point: | 129.3°C |
| Safety Data | |
 |
|
