| Identification | |
| Name: | 1-Chloro-3-fluoro-2-propanol |
| Synonyms: | 1-Chloro-3-fluoroisopropanol |
| CAS: | 453-11-2 |
| EINECS: | -0 |
| Molecular Formula: | C3H6ClFO |
| Molecular Weight: | 112.53 |
| InChI: | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2929 |
| Flash Point: | 49.4°C |
| Boiling Point: | 158.1°Cat760mmHg |
| Density: | 1.3 |
| Refractive index: | 1.438 |
| Specification: | Safety Statements:23-36/37 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Flash Point: | 49.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
