| Identification | |
| Name: | 2-Propanol,1,3-difluoro- |
| Synonyms: | 1,3-Difluoro-2-propanol;1,3-Difluoroisopropanol; 1,3-Difluoropropane-2-ol; NSC 21305; NSC 76034 |
| CAS: | 453-13-4 |
| EINECS: | 207-216-6 |
| Molecular Formula: | C3H6 F2 O |
| Molecular Weight: | 96.07 |
| InChI: | InChI=1/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 3/PG 3 |
| Density: | 1.24 |
| Refractive index: | n20/D 1.373(lit.) |
| Specification: |
1,3-Difluoro-2-propanol (CAS No.453-13-4) is a metabolic poison which disrupts the citric acid cycle and is used as a rodenticide, similar to sodium fluoroacetate. It is the main ingredient (along with 1-chloro-3-fluoro-2-propanol) in the rodenticide product Gliftor which was widely used in the former USSR. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
