| Identification | |
| Name: | 1,2-Propanediol,3-fluoro- |
| Synonyms: | 1-Fluoro-2,3-propanediol;3-Fluoro-1,2-propanediol; DL-1-Fluorodeoxyglycerol; NSC 21306 |
| CAS: | 453-16-7 |
| Molecular Formula: | C3H7 F O2 |
| Molecular Weight: | 94.08 |
| InChI: | InChI=1/C3H7FO2/c4-3(1-5)2-6/h3,5-6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6.1/PG 2 |
| Flash Point: | 87.2°C |
| Boiling Point: | 205.4°Cat760mmHg |
| Density: | 1.192g/cm3 |
| Refractive index: | n20/D 1.422(lit.) |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 87.2°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
