| Identification | |
| Name: | Hexanoic acid,2-methyl- |
| Synonyms: | Caproicacid, a-methyl- (3CI);2-Hexanecarboxylic acid;2-Methylcaproic acid;a-Methylcaproic acid; |
| CAS: | 4536-23-6 |
| EINECS: | 224-883-9 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 0.916 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.418-1.422 |
| Solubility: | Very soluble |
| Appearance: | Clear very slight yellow liquid. |
| Specification: |
2-Methylhexanoic acid with CAS Registry Number of 4536-23-6 is clear colorless to slightly yellow liquid. It is incompatible with strong oxidizing agents, strong bases. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . 2-Methylhexanoic acid is also known as 2-Hexanecarboxylic acid ; 2-Methylcaproic acid ; 2-Methylhexanoic acid ; 4-02-00-00969 (Beilstein Handbook Reference) ; FEMA No. 3191 ; Hexanoic acid, 2-methyl- ; Methylhexanoic acid ; alpha-Methylcaproic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
