| Identification | |
| Name: | Butyric acid, 2-amino-4-mercapto-, DL- (9CI) |
| Synonyms: | (+-)-Homocysteine;BRN 5493225;D,L-Homocysteine;DL-2-Amino-4-mercaptobutyric acid;NSC 206252;454-29-5; |
| CAS: | 454-29-5 |
| EINECS: | 207-222-9 |
| Molecular Formula: | C4H9NO2S |
| Molecular Weight: | 135.18 |
| InChI: | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.259 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.537 |
| Appearance: | white powder |
| Specification: |
D,L-Homocysteine (454-29-5) is a kind of amino acids with appearance of white powder. It is also called for (+-)-Homocysteine ; DL-2-Amino-4-mercaptobutyric acid ; NSC 206252 ; USAF B-12 ; Butyric acid, 2-amino-4-mercapto-, DL-(9CI) ; DL-Homocysteine . It is stable and incompatible with strong oxidizing agents. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
