| Identification | |
| Name: | Aceticacid, 2,2-difluoro-, ethyl ester |
| Synonyms: | Aceticacid, difluoro-, ethyl ester (6CI,7CI,8CI,9CI);2,2-Difluoroacetic acid ethylester;Difluoroacetic acid ethyl ester;Ethyl 2,2-difluoroacetate;Ethyl difluoroacetic; |
| CAS: | 454-31-9 |
| EINECS: | 207-223-4 |
| Molecular Formula: | C4H6F2O2 |
| Molecular Weight: | 124.09 |
| InChI: | InChI=1/C4H6F2O2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2924 |
| Density: | 1.242 |
| Refractive index: | 1.3465-1.3485 |
| Appearance: | Colorless to light brown clear liquid |
| Specification: |
Aceticacid, 2,2-difluoro-, ethyl ester , its CAS NO. is 454-31-9, the synonyms are Ethyl difluoroacetate ; and Acetic acid, difluoro-, ethyl ester . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
