| Identification | |
| Name: | benzoyl fluoride |
| Synonyms: | BENZOYL FLUORIDE;Benzoyl fluoride 99%;Benzoylfluoride99% |
| CAS: | 455-32-3 |
| EINECS: | 207-244-9 |
| Molecular Formula: | C7H5FO |
| Molecular Weight: | 124.1124 |
| InChI: | InChI=1S/C7H5FO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 8 |
| Refractive index: | n20/D 1.496(lit.) |
| Appearance: | yellow liquid |
| Specification: | clear yellow to red-brown liquid Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
T: Toxic
F: Flammable
C: Corrosive
|
 |
|
