| Identification | |
| Name: | Ethanone,1-(3-fluorophenyl)- |
| Synonyms: | Acetophenone,3'-fluoro- (6CI,7CI,8CI);1-(3-Fluorophenyl)ethanone;1-Acetyl-3-fluorobenzene;3-Acetyl-1-fluorobenzene;3-Fluorophenyl methyl ketone;3'-Fluoroacetophenone;NSC 88301;m-Fluoroacetophenone;m-Fluorophenyl methyl ketone; |
| CAS: | 455-36-7 |
| EINECS: | 207-245-4 |
| Molecular Formula: | C8H7FO |
| Molecular Weight: | 138.14 |
| InChI: | InChI=1/C8H7FO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6.1/PG 3 |
| Melting Point: | -3°C |
| Density: | 1.126 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.508-1.51 |
| Solubility: | Slightly soluble |
| Appearance: | Clear colorless to light yellow liquid. |
| Specification: | clear colourless to yellow liquid Safety Statements:26-36-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
