| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-fluoro-, methyl ester |
| Synonyms: | Isonicotinic acid, 2-fluoro-, methyl ester (8CI);NSC402994; |
| CAS: | 455-69-6 |
| Molecular Formula: | C7H6FNO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H6FNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.5°C |
| Boiling Point: | 227.7°Cat760mmHg |
| Density: | 1.243g/cm3 |
| Refractive index: | n20/D 1.488 |
| Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 91.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
