| Identification | |
| Name: | Hydrochloride of the di-n-butylaminopropyl 3-iodo-4-fluorobenzoate |
| Synonyms: | 4-Fluoro-3-iodobenzoic acid, 3-(dibutylamino)propyl ester, hydrochloride;3-(dibutylamino)propyl 4-fluoro-3-iodobenzoate hydrochloride(1:1);Hydrochloride of the di-n-butylaminopropyl 3-iodo-4-fluorobenzoate;BENZOIC ACID, 4-FLUORO-3-IODO-, 3-(DIBUTYLAMINO)PROPYL ESTER, HYDROCHLORIDE;455-80-1;AC1Q4NFF;AC1L1U7K;AR-1E7497;LS-37459;Dibutylaminopropyl 3-iodo-4-fluorobenzoate HCl;3-(dibutylamino)propyl 4-fluoro-3-iodobenzoate hydrochloride;3-(dibutylamino)propyl 4-fluoro-3-iodobenzoate hydrochloride (1:1) |
| CAS: | 455-80-1 |
| Molecular Formula: | C18H27FINO2 . ClH |
| Molecular Weight: | 471.7763 |
| InChI: | InChI=1/C18H27FINO2.ClH/c1-3-5-10-21(11-6-4-2)12-7-13-23-18(22)15-8-9-16(19)17(20)14-15;/h8-9,14H,3-7,10-13H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 226.1°C |
| Boiling Point: | 450.2°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Hydrochloride of the di-n-butylaminopropyl 3-iodo-4-fluorobenzoate , its CAS NO. is 455-80-1, the synonyms are 4-Fluoro-3-iodobenzoic acid, 3-(dibutylamino)propyl ester, hydrochloride ; Dibutylaminopropyl 3-iodo-4-fluorobenzoate HCl ; Benzoic acid, 4-fluoro-3-iodo-, 3-(dibutylamino)propyl ester, hydrochloride . |
| Flash Point: | 226.1°C |
| Safety Data | |
 |
|
