| Identification | |
| Name: | Cyclopentanol,1-(aminomethyl)- |
| Synonyms: | 1-(Aminomethyl)cyclopentan-1-ol;1-(Aminomethyl)cyclopentanol; |
| CAS: | 45511-81-7 |
| Molecular Formula: | C6H13NO |
| Molecular Weight: | 115.17 |
| InChI: | InChI=1/C6H13NO/c7-5-6(8)3-1-2-4-6/h8H,1-5,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.058 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
The systematic name of this chemical is1-(aminomethyl)cyclopentanol. With the CAS registry number 45511-81-7. it is also named as cyclopentanol, 1-(aminomethyl)-. The formula is C6H13NO and the molecular weight is 115.17. If you want to store this chemical, please keep containers tightly sealed, and store in cool, dry and ventilate place. The other characteristics of 1-(Aminomethyl)cyclopentanol can be summarized as: (1)ACD/LogP: -0.11; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 46.25×Å2; (11)Index of Refraction: 1.514; (12)Molar Refractivity: 32.784 cm3; (13)Molar Volume: 108.876 cm3; (14)Polarizability: 12.996×10-24 cm3; (15)Surface Tension: 46.745 dyne/cm; (16)Flash Point: 73.578 °C; (17)Enthalpy of Vaporization: 50.527 kJ/mol; (18)Boiling Point: 198.049 °C at 760 mmHg; (19)Vapour Pressure: 0.093 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
