| Identification | |
| Name: | 1-Piperazineethanamine,4-(phenylmethyl)- |
| Synonyms: | Piperazine,1-(2-aminoethyl)-4-benzyl- (7CI,8CI);1-(2-Aminoethyl)-4-benzylpiperazine;2-(4-Benzylpiperazin-1-yl)ethylamine; |
| CAS: | 4553-21-3 |
| Molecular Formula: | C13H21N3 |
| Molecular Weight: | 219.33 |
| InChI: | InChI=1/C13H21N3/c14-6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13/h1-5H,6-12,14H2/p+3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.6°C |
| Boiling Point: | 118 °C |
| Density: | 1.053 g/cm3 |
| Appearance: | liquid |
| Specification: | Safety Statements:26-36/37/39-37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37:Wear suitable gloves |
| Flash Point: | 154.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
