Identification |
Name: | 1-Piperazineethanamine,4-(phenylmethyl)- |
Synonyms: | Piperazine,1-(2-aminoethyl)-4-benzyl- (7CI,8CI);1-(2-Aminoethyl)-4-benzylpiperazine;2-(4-Benzylpiperazin-1-yl)ethylamine; |
CAS: | 4553-21-3 |
Molecular Formula: | C13H21N3 |
Molecular Weight: | 219.33 |
InChI: | InChI=1/C13H21N3/c14-6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13/h1-5H,6-12,14H2/p+3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 154.6°C |
Boiling Point: | 118 °C |
Density: | 1.053 g/cm3 |
Appearance: | liquid |
Specification: | Safety Statements:26-36/37/39-37 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 37:Wear suitable gloves |
Flash Point: | 154.6°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |