| Identification | |
| Name: | Pentanedinitrile,2-methyl- |
| Synonyms: | Glutaronitrile,2-methyl- (6CI,7CI,8CI); 1,3-Dicyanobutane; 2,4-Dicyanobutane;2-Methylglutaronitrile; 2-Methylpentanedinitrile; Diacrylonitrile; a-Methylglutarodinitrile; a-Methylglutaronitrile |
| CAS: | 4553-62-2 |
| EINECS: | 224-923-5 |
| Molecular Formula: | C6H8 N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-6(5-8)3-2-4-7/h6H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | -45 C |
| Flash Point: | 126 C |
| Boiling Point: | 274 C |
| Density: | 0.942 g/cm3 |
| Refractive index: | n20/D 1.434(lit.) |
| Water Solubility: | 1-5 g/100 ml |
| Solubility: | 1-5 g/100 ml |
| Appearance: | Clear liquid |
| Specification: |
Methylglutaronitrile ,its cas register number is 4553-62-2. It also can be called Pentanedinitrile, 2-methyl- ; Pentanedinitrile, methyl- ; Glutaronitrile, methyl- ; and 2-methylpentanedinitrile . Methylglutaronitrile (CAS NO.4553-62-2) may polymerize in the presence of metals and some metal compounds. It is readily absorbed through the skin and is combustible. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 126 C |
| Color: | Liquid at ambient temperatures. |
| Safety Data | |
 |
|
