| Identification | |
| Name: | 2,3-dibromopropionitrile |
| Synonyms: | 2,3-Dibromorpropionitrile; 4-Hydroxyphenylacetic Acid Methyl Ester; 2,3-Dibromopropionitrile, 90%; Dibromopropionitrile; |
| CAS: | 4554-16-9 |
| EINECS: | 224-925-6 |
| Molecular Formula: | C3H3Br2N |
| Molecular Weight: | 212.87 |
| InChI: | InChI=1/C3H3Br2N/c4-1-3(5)2-6/h3H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 172? |
| Density: | 2.14 |
| Refractive index: | 1.545 |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 172? |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
