| Identification | |
| Name: | 4-NITROBENZENEDIAZONIUM FLUOBORATE |
| Synonyms: | 4-Nitrobenzenediazonium Tetrafluoroborate 98%;p-NITRO-PHENYLDIAZONIUM FLUOBORATE;BENZENEDIAZONIUM, p-NITRO-, TETRAFLUORO-BORATE(1-);BENZENEDIAZONIUM, 4-NITRO-, TETRA-FLUOROBORATE(1-) (9CI);4-Nitrobenzenediazonium tetrafluoroborate;100-05-0;154960-09-5;Benzenediazonium, p-nitro-, tetrafluoroborate(1-);120600-85-3;14368-49-1;15003-70-0;Benzenediazonium, 4-nitro-;p-Nitrophenyldiazonium fluoborate;p-Nitrobenzenediazonium tetrafluoroborate;Benzenediazonium, 4-nitro-, tetrafluoroborate(1-);4-nitrobenzenediazonium; tetrafluoroboron;p-Nitrophenyl diazonium fluoroborate;4-Nitrobenzenediazonium tetrafluoroborate(1-);p-Nitrobenzenediazonium fluoborate;154960-10-8;4-Nitrophenyldiazonium tetrafluoroborate;Benzenediazonium, 4-nitro-, tetrafluoroborate (1-);4-Nitrobenzenediazonium fluoroborate;198975-25-6;Benzenediazonium, p-nitro-, tetrafluoroborate (1-);p-Nitrobenzenediazonium fluoroborate;p-Nitrophenyldiazonium tetrafluoroborate;15151-17-4; |
| CAS: | 456-27-9 |
| EINECS: | 207-261-1 |
| Molecular Formula: | C6H4N3O2•BF4 |
| Molecular Weight: | 236.94 |
| InChI: | InChI=1/C6H4BF3N3O2.FH/c8-7(9)13(10)11-5-1-3-6(4-2-5)12(14)15;/h1-4H;1H/q+1;/p-1/b13-11-; |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 8/PG 2 |
| Melting Point: | 144-148 °C (dec.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, moisture, strong bases. Avoid mechanical shock. |
| Solubility: |
|
| Appearance: | solid |
| Specification: | Pale Yellow Solid Safety Statements:22-24/25-36/39-45-36/37/39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/39:Wear suitable protective clothing and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
