Identification |
Name: | Benzene,1-(bromomethyl)-3-fluoro- |
Synonyms: | Toluene,a-bromo-m-fluoro- (6CI,7CI,8CI);(3-Fluorophenyl)methyl bromide;1-(Bromomethyl)-3-fluorobenzene;3-(Bromomethyl)fluorobenzene;NSC 91494;m-Fluorobenzylbromide;a-Bromo-3-fluorotoluene; |
CAS: | 456-41-7 |
EINECS: | 207-263-2 |
Molecular Formula: | C7H6BrF |
Molecular Weight: | 189.03 |
InChI: | InChI=1/C7H6BrF/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 |
Density: | 1.541 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Reacts with water to form toxic fumes. |
Refractive index: | 1.545-1.548 |
Appearance: | Colorless to light yellow liquid |
Packinggroup: | III |
HS Code: | 29036990 |
Sensitive: | Lachrymatory |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |