| Identification |
| Name: | Benzene,1-(chloromethyl)-3-fluoro- |
| Synonyms: | a-Chloro-m-fluorotoluene;Toluene,a-chloro-m-fluoro- (6CI,7CI,8CI);1-(Chloromethyl)-3-fluorobenzene;3-Fluorophenylmethylchloride;NSC 60720;m-Fluorobenzyl chloride;a-Chloro-3-fluorotoluene; |
| CAS: | 456-42-8 |
| EINECS: | 207-264-8 |
| Molecular Formula: | C7H6ClF |
| Molecular Weight: | 144.57 |
| InChI: | InChI=1/C7H6ClF/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 8/PG 2 |
| Density: | 1.194 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5115-1.5135 |
| Solubility: | 40 g/L (20 oC) in water |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Store protected from moisture. Do not store in steel container. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
