| Identification | |
| Name: | 2-Oxazolecarboxylicacid, 5-methyl- |
| Synonyms: | 5-Methyloxazole-2-carboxylic acid; |
| CAS: | 45676-69-5 |
| Molecular Formula: | C5H5NO3 |
| Molecular Weight: | 127.10 |
| InChI: | InChI=1/C5H5NO3/c1-3-2-6-4(9-3)5(7)8/h2H,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.348 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
The cas register number of 5-Methyloxazole-2-carboxylic acid is 45676-69-5. It also can be called as 2-Oxazolecarboxylicacid, 5-methyl- and the Systematic name about this chemical is 5-methyl-1,3-oxazole-2-carboxylic acid. Physical properties about 5-Methyloxazole-2-carboxylic acid are: (1)ACD/LogP: 0.15; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 63.33Å2; (10)Index of Refraction: 1.514; (11)Molar Refractivity: 28.399 cm3; (12)Molar Volume: 94.256 cm3; (13)Polarizability: 11.258x10-24cm3; (14)Surface Tension: 53.715 dyne/cm; (15)Enthalpy of Vaporization: 55.722 kJ/mol; (16)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
