| Identification |
| Name: | (R)--Methyl-3-(1-methylethyl)benzenepropanal |
| Synonyms: | (R)-FlorhydralR;(R)--Methyl-3-(1-methylethyl)benzenepropanal |
| CAS: | 457928-60-8 |
| Molecular Formula: | C13H18O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H18O/c1-10(2)12-5-4-6-13(9-12)11(3)7-8-14/h4-6,8-11H,7H2,1-3H3/t11-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 103.6°C |
| Boiling Point: | 251.3°C at 760 mmHg |
| Density: | 0.935g/cm3 |
| Refractive index: | 1.496 |
| Flash Point: | 103.6°C |
| Usage: | A chiral fragrance. The (-)-enantiomer has a typical racemic Florhydral smell-floral, fresh, green, muguet-like, but more marine, and more plastic |
| Safety Data |
| |
 |
