| Identification | |
| Name: | Benzeneacetaldehyde, a-(hydroxyimino)-, oxime |
| Synonyms: | Glyoxal,phenyl-, dioxime (8CI); Glyoxime, phenyl- (6CI,7CI); Monophenylglyoxime; NSC152094; Phenylglyoxal dioxime; Phenylglyoxime; a-Phenyldioxime |
| CAS: | 4589-97-3 |
| EINECS: | 224-976-4 |
| Molecular Formula: | C8H8 N2 O2 |
| Molecular Weight: | 164.18 |
| InChI: | InChI=1/C8H8N2O2/c11-9-6-8(10-12)7-4-2-1-3-5-7/h1-6,10,12H/b8-6+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.2°C |
| Boiling Point: | 303.2°Cat760mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.567 |
| Specification: |
2-(Hydroxyimino)-2-phenylacetaldehyde oxime , its cas register number is 4589-97-3. It also can be called Glyoxal, phenyl-, dioxime ; alpha-(Hydroxyimino)benzeneacetaldehyde oxime ; and Benzeneacetaldehyde, alpha-(hydroxyimino)-, oxime . |
| Flash Point: | 137.2°C |
| Safety Data | |
 |
|
