| Identification | |
| Name: | 4-Fluorophenylacetone |
| Synonyms: | 2-Propanone,(p-fluorophenyl)- (6CI,7CI);2-Propanone, 1-(p-fluorophenyl)- (8CI);(4-Fluorophenyl)acetone;(p-Fluorophenyl)acetone;1-(4-Fluorophenyl)-2-propanone;3-(4-Fluorophenyl)-2-propanone;4-Fluorobenzyl methyl ketone;p-Fluorobenzylmethyl ketone;2-Propanone,1-(4-fluorophenyl)-; |
| CAS: | 459-03-0 |
| EINECS: | 207-284-7 |
| Molecular Formula: | C9H9FO |
| Molecular Weight: | 152.17 |
| InChI: | InChI=1/C9H9FO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.139 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4948-1.4968 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | clear yellow liquid |
| Specification: |
4-Fluorophenylacetone (CAS NO.459-03-0), its Synonyms are (4-Fluorophenyl)acetone ; 1-(4-Fluorophenyl)acetone ; 2-Propanone, 1-(4-fluorophenyl)- ; (p-Fluorophenyl)acetone ; p-Fluoro benzyl methyl ketone ; 4'-Fluorophenylacetone ; 1-(4-Fluorophenyl)-2-propanone ; 1-acetonyl-4-fluorobenzene . It is clear yellow liquid. |
| HS Code: | 29147090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
