| Identification | |
| Name: | 4-Fluorocinnamic acid |
| Synonyms: | p-Fluorocinnamic acid |
| CAS: | 459-32-5 |
| EINECS: | 207-288-9 |
| Molecular Formula: | C9H7FO2 |
| Molecular Weight: | 166.15 |
| InChI: | InChI=1/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.285 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?p-Fluorocinnamic acid (CAS NO.459-32-5) is also named as 2-Propenoic acid, 3-(4-fluorophenyl)- ;?4-Fluorocinnamic acid ;?(E)-3-(2-hydroxyphenyl)acrylic acid .?p-Fluorocinnamic acid (CAS NO.459-32-5) is?white to light yellow crystal powder. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
