| Identification | |
| Name: | Benzenemethanol,4-fluoro- |
| Synonyms: | Benzylalcohol, p-fluoro- (6CI,7CI,8CI);(4-Fluorophenyl)methanol;4-Fluorobenzenemethanol;p-Fluorophenylmethanol;NSC 63347;p-Fluorobenzyl alcohol; |
| CAS: | 459-56-3 |
| EINECS: | 207-292-0 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.15 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5065-1.5095 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless or slightly yellow liquid. |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:23-24/25-45-36/37/39-27-26 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29062900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
