| Identification |
| Name: | p-Fluoroanisole |
| Synonyms: | 4-Fluoroanisole; 1-Fluoro-4-methoxybenzene |
| CAS: | 459-60-9 |
| EINECS: | 207-295-7 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3271 |
| Density: | 1.114 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4867-1.4887 |
| Solubility: | Insoluble |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | An Acetanilide and Anisole derivative metabolite by liver. |
| Safety Data |
| Hazard Symbols |
F: Flammable
|
| |
 |
