| Identification | |
| Name: | 4-Methoxybenzenediazonium tetrafluoroborate |
| Synonyms: | 4-METHOXYBENZENEDIAZONIUM TETRAFLUOROBORATE;4-MethoxybenzenediazoniumTetrafluoroborate98% |
| CAS: | 459-64-3 |
| EINECS: | 207-296-2 |
| Molecular Formula: | C7H7N2O.BF4 |
| Molecular Weight: | 221.95 |
| InChI: | InChI=1/C7H7N2O.B.4FH/c1-10-7-4-2-6(9-8)3-5-7;;;;;/h2-5H,1H3;;4*1H/q+1;+3;;;;/p-4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Melting Point: | 142-144 °C(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: | grey-brown powder Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
