| Identification | |
| Name: | 1H-Inden-1-one,2,3-dihydro-5-methyl- |
| Synonyms: | 1-Indanone,5-methyl- (6CI,7CI,8CI); |
| CAS: | 4593-38-8 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C10H10O/c1-7-2-4-9-8(6-7)3-5-10(9)11/h2,4,6H,3,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 108.388°C |
| Boiling Point: | 262.419°C at 760 mmHg |
| Density: | 1.113g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
1H-Inden-1-one,2,3-dihydro-5-methyl- , with CAS number of 4593-38-8, can be called 1H-inden-1-one, 2,3-dihydro-5-methyl- ; 5-Methylindan-1-one ; 4593-38-8 [RN] ; 5-Methyl-1-Indanone .It is a white to light yellow crystal powder. |
| Flash Point: | 108.388°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
