| Identification | |
| Name: | Propanoic acid,3-fluoro- |
| Synonyms: | Propionicacid, 3-fluoro- (6CI,8CI); 3-Fluoropropanoic acid; 3-Fluoropropionic acid; b-Fluoropropionic acid |
| CAS: | 461-56-3 |
| EINECS: | 207-311-2 |
| Molecular Formula: | C3H5 F O2 |
| Molecular Weight: | 92.08 |
| InChI: | InChI=1/C3H5FO2/c4-2-1-3(5)6/h1-2H2,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65.9°C |
| Boiling Point: | 83-84(1.87kPa) |
| Density: | 1.178g/cm3 |
| Refractive index: | 1.37 |
| Specification: |
3-Fluoropropionic acid , its cas register number is 461-56-3. It also can be called beta-Fluoropropionic acid ; and Propanoic acid, 3-fluoro- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Flash Point: | 65.9°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
