Identification |
Name: | Pyridine,2-fluoro-4-methyl- |
Synonyms: | 4-Picoline,2-fluoro- (8CI);2-Fluoro-4-picoline; |
CAS: | 461-87-0 |
EINECS: | -0 |
Molecular Formula: | C6H6FN |
Molecular Weight: | 111.12 |
InChI: | InChI=1S/C6H6FN/c1-5-2-3-8-6(7)4-5/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 1993 |
Density: | 1.078 |
Refractive index: | 1.472 |
Appearance: | Clear colourless to light yellow liquid |
Specification: | Clear colourless to light yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Packinggroup: | III |
Storage Temperature: | Room temperature. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |