| Identification | |
| Name: | 7-Tridecanone |
| Synonyms: | ENANTHONE;DI-N-HEXYL KETONE;DIHEXYL KETONE;7-TRIDECANONE;di-Normal-hexyl ketone;Hexyl ketone;hexylketone;tridecan-7-one |
| CAS: | 462-18-0 |
| EINECS: | 207-324-3 |
| Molecular Formula: | C13H26O |
| Molecular Weight: | 198.34 |
| InChI: | InChI=1/C13H26O/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h3-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 30-32.5 °C(lit.) |
| Flash Point: | >230 °F |
| Boiling Point: | 264 °C(lit.) |
| Density: | 0.825 g/mL at 25 °C(lit.) |
| Refractive index: | 1.431 |
| Specification: |
7-Tridecanone with cas registry number of 462-18-0 is also known as Dihexyl ketone ; Di-n-hexyl ketone ; Enanthone ; Hexyl ketone ; Tridecan-7-one . It is a flammable liquid . It would emit acrid smoke and irritating vapors when heated to decomposition, so it should be stored in a tightly closed container when not in use and stored in a cool, dry place. 7-Tridecanone with cas registry number of 462-18-0 is used as a intermediate . |
| Flash Point: | >230 °F |
| Safety Data | |
 |
|
