| Identification | |
| Name: | Carbonochloridic acid,2-fluoroethyl ester |
| Synonyms: | Formicacid, chloro-, 2-fluoroethyl ester (8CI); 2-Fluoroethyl carbonochloridate;2-Fluoroethyl chloroformate |
| CAS: | 462-27-1 |
| Molecular Formula: | C3H4 Cl F O2 |
| Molecular Weight: | 126.52 |
| InChI: | InChI=1/C3H4ClFO2/c4-3(6)7-2-1-5/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2742 6.1/PG 2 |
| Flash Point: | 51.8°C |
| Boiling Point: | 115.5°Cat760mmHg |
| Density: | 1.286g/cm3 |
| Refractive index: | n20/D 1.4(lit.) |
| Specification: | Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 51.8°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
