| Identification |
| Name: | Cyclohexanecarboxylicacid, methyl ester |
| Synonyms: | Hexahydrobenzoicacid methyl ester;Methyl cyclohexylcarboxylate;Methyl hexahydrobenzoate; |
| CAS: | 4630-82-4 |
| EINECS: | 225-050-2 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-10-8(9)7-5-3-2-4-6-7/h7H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Density: | 0.995 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.442-1.444 |
| Water Solubility: | ALMOST INSOLUBLE |
| Solubility: | almost insoluble in water |
| Appearance: | pale yellow clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Flammables-area. Store in a cool, dry area away from incompatible substances. |
| Safety Data |
| |
 |
