| Identification | |
| Name: | TRICLOSAN METHYL ETHER |
| CAS: | 4640-01-1 |
| Molecular Formula: | C13H9Cl3O2 |
| Molecular Weight: | 303.57 |
| InChI: | InChI=1/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Flash Point: | 128.5°C |
| Boiling Point: | 358.7°C at 760 mmHg |
| Density: | 1.38g/cm3 |
| Refractive index: | 1.588 |
| Appearance: | colourless syrup |
| Specification: | Colourless Syrup usageEng:A bactericide detected in rivers and lakes. The current lot contains 8.7% d2, 0.2% d1 and 0.002% d0. Safety Statements:60-61 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 128.5°C |
| Storage Temperature: | Refrigerator |
| Usage: | A bactericide detected in rivers and lakes |
| Safety Data | |
 |
|
