Identification |
Name: | Benzo[b]thiophene-3-carbonitrile,2-amino-4,5,6,7-tetrahydro- |
Synonyms: | 2-Amino-3-cyano-4,5,6,7-tetrahydrobenzo[b]thiophene;2-Amino-3-cyano-4,5-tetramethylenethiophene; 2-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carbonitrile;NSC 86907 |
CAS: | 4651-91-6 |
EINECS: | 225-085-3 |
Molecular Formula: | C9H10 N2 S |
Molecular Weight: | 178.2541 |
InChI: | InChI=1/C9H10N2S/c10-5-7-6-3-1-2-4-8(6)12-9(7)11/h1-4,11H2 |
Molecular Structure: |
|
Properties |
Transport: | 3439 |
Density: | 1.27 g/cm3 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|