| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 1-methylethyl ester |
| Synonyms: | Methacrylicacid, isopropyl ester (6CI,7CI,8CI); 1-Methylethyl 2-methylpropenoate;Isopropyl 2-methyl-2-propenoate; Isopropyl 2-methylacrylate; Isopropylmethacrylate; NSC 32625 |
| CAS: | 4655-34-9 |
| EINECS: | 225-094-2 |
| Molecular Formula: | C7H12 O2 |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C7H12O2/c1-5(2)7(8)9-6(3)4/h6H,1H2,2-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3272 |
| Flash Point: | 31°C |
| Boiling Point: | 125°Cat760mmHg |
| Density: | 0.897g/cm3 |
| Refractive index: | 1.415 |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 31°C |
| Safety Data | |
 |
|
