Identification |
Name: | Furo[3,4-c]pyridine-1,3-dione |
Synonyms: | 3,4-Pyridinedicarboxylicanhydride (6CI,8CI);3,4-Pyridinedicarboxylic acid anhydride;Cinchomeronicacid anhydride;Cinchomeronic anhydride;NSC 127964; |
CAS: | 4664-08-8 |
Molecular Formula: | C7H3NO3 |
Molecular Weight: | 149.1 |
InChI: | InChI=1/C7H3NO3/c9-6-4-1-2-8-3-5(4)7(10)11-6/h1-3H |
Molecular Structure: |
 |
Properties |
Melting Point: | 75-77 °C(lit.)
|
Flash Point: | 156.2°C |
Boiling Point: | 334.6°Cat760mmHg |
Density: | 1.556g/cm3 |
Refractive index: | 1.622 |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 156.2°C |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |